instruction stringlengths 220 702 | input stringclasses 1 value | output stringclasses 10 values |
|---|---|---|
Given the rest of reaction components:
reactant 1: CC1(C)OB(c2ccc3ncccc3c2)OC1(C)C
reactant 2: Cc1ccc2c(cnn2C2CCCCO2)c1Br
ligand: CC(C)(C)P(C(C)(C)C)C(C)(C)C
base: [Li+].CC(C)(C)[O-]
Solvent list for selection:
C1CCOC1,CN(C)C=O,CC#N
Optimal solvent:
| 2 | |
Given the rest of reaction components:
reactant 1: CC1(C)OB(c2ccc3ncccc3c2)OC1(C)C
reactant 2: Cc1ccc2c(cnn2C2CCCCO2)c1Br
ligand: c1ccc(P(c2ccccc2)c2ccccc2)cc1
base: [Li+].CC(C)(C)[O-]
Solvent list for selection:
CN(C)C=O,C1CCOC1,CC#N
Optimal solvent:
| 1 | |
Given the rest of reaction components:
reactant 1: CC1(C)OB(c2ccc3ncccc3c2)OC1(C)C
reactant 2: Cc1ccc2c(cnn2C2CCCCO2)c1Br
ligand: CN(C)Cc1ccc(P(C(C)(C)C)C(C)(C)C)cc1
base: [Li+].CC(C)(C)[O-]
Solvent list for selection:
CC#N,CN(C)C=O,C1CCOC1
Optimal solvent:
| 0 | |
Given the rest of reaction components:
reactant 1: CC1(C)OB(c2ccc3ncccc3c2)OC1(C)C
reactant 2: Cc1ccc2c(cnn2C2CCCCO2)c1Br
ligand: C1CCC(P(C2CCCCC2)C2CCCCC2)CC1
base: [Li+].CC(C)(C)[O-]
Solvent list for selection:
C1CCOC1,CN(C)C=O,CC#N
Optimal solvent:
| 2 | |
Given the rest of reaction components:
reactant 1: CC1(C)OB(c2ccc3ncccc3c2)OC1(C)C
reactant 2: Cc1ccc2c(cnn2C2CCCCO2)c1Br
ligand: Cc1ccccc1P(c1ccccc1C)c1ccccc1C
base: [Li+].CC(C)(C)[O-]
Solvent list for selection:
C1CCOC1,CN(C)C=O,CC#N
Optimal solvent:
| 0 | |
Given the rest of reaction components:
reactant 1: CC1(C)OB(c2ccc3ncccc3c2)OC1(C)C
reactant 2: Cc1ccc2c(cnn2C2CCCCO2)c1Br
ligand: CCCCP(C12CC3CC(CC(C3)C1)C2)C12CC3CC(CC(C3)C1)C2
base: [Li+].CC(C)(C)[O-]
Solvent list for selection:
CC#N,CN(C)C=O,C1CCOC1
Optimal solvent:
| 0 | |
Given the rest of reaction components:
reactant 1: CC1(C)OB(c2ccc3ncccc3c2)OC1(C)C
reactant 2: Cc1ccc2c(cnn2C2CCCCO2)c1Br
ligand: COc1cccc(OC)c1-c1ccccc1P(C1CCCCC1)C1CCCCC1
base: [Li+].CC(C)(C)[O-]
Solvent list for selection:
CN(C)C=O,CC#N,C1CCOC1
Optimal solvent:
| 1 | |
Given the rest of reaction components:
reactant 1: CC1(C)OB(c2ccc3ncccc3c2)OC1(C)C
reactant 2: Cc1ccc2c(cnn2C2CCCCO2)c1Br
ligand: CC(C)(C)P([C]1C=C[CH][C@@H]1[Fe]C1C=CC=C1P(C(C)(C)C)C(C)(C)C)C(C)(C)C
base: [Li+].CC(C)(C)[O-]
Solvent list for selection:
CN(C)C=O,C1CCOC1,CC#N
Optimal solvent:
| 1 | |
Given the rest of reaction components:
reactant 1: CC1(C)OB(c2ccc3ncccc3c2)OC1(C)C
reactant 2: Cc1ccc2c(cnn2C2CCCCO2)c1Br
ligand: CC(C)c1cc(C(C)C)c(-c2ccccc2P(C2CCCCC2)C2CCCCC2)c(C(C)C)c1
base: [Li+].CC(C)(C)[O-]
Solvent list for selection:
C1CCOC1,CN(C)C=O,CC#N
Optimal solvent:
| 0 | |
Given the rest of reaction components:
reactant 1: CC1(C)OB(c2ccc3ncccc3c2)OC1(C)C
reactant 2: Cc1ccc2c(cnn2C2CCCCO2)c1Br
ligand: C1=C[C@H]2[Fe][C@@H]1[C]2P(c1ccccc1)c1ccccc1
base: [Li+].CC(C)(C)[O-]
Solvent list for selection:
CN(C)C=O,CC#N,C1CCOC1
Optimal solvent:
| 1 | |
Given the rest of reaction components:
reactant 1: CC1(C)OB(c2ccc3ncccc3c2)OC1(C)C
reactant 2: Cc1ccc2c(cnn2C2CCCCO2)c1Br
ligand: CC1(C)c2cccc(P(c3ccccc3)c3ccccc3)c2Oc2c(P(c3ccccc3)c3ccccc3)cccc21
base: [Li+].CC(C)(C)[O-]
Solvent list for selection:
CN(C)C=O,CC#N,C1CCOC1
Optimal solvent:
| 1 | |
Given the rest of reaction components:
reactant 1: CC1(C)OB(c2ccc3ncccc3c2)OC1(C)C
reactant 2: Cc1ccc2c(cnn2C2CCCCO2)c1Br
ligand: CC(C)(C)P(C(C)(C)C)C(C)(C)C
base: C(=O)(O)[O-].[Na+]
Solvent list for selection:
CN(C)C=O,C1CCOC1,CC#N
Optimal solvent:
| 2 | |
Given the rest of reaction components:
reactant 1: CC1(C)OB(c2ccc3ncccc3c2)OC1(C)C
reactant 2: Cc1ccc2c(cnn2C2CCCCO2)c1Br
ligand: c1ccc(P(c2ccccc2)c2ccccc2)cc1
base: C(=O)(O)[O-].[Na+]
Solvent list for selection:
C1CCOC1,CN(C)C=O,CC#N
Optimal solvent:
| 0 | |
Given the rest of reaction components:
reactant 1: CC1(C)OB(c2ccc3ncccc3c2)OC1(C)C
reactant 2: Cc1ccc2c(cnn2C2CCCCO2)c1Br
ligand: CN(C)Cc1ccc(P(C(C)(C)C)C(C)(C)C)cc1
base: C(=O)(O)[O-].[Na+]
Solvent list for selection:
CC#N,CN(C)C=O,C1CCOC1
Optimal solvent:
| 0 | |
Given the rest of reaction components:
reactant 1: CC1(C)OB(c2ccc3ncccc3c2)OC1(C)C
reactant 2: Cc1ccc2c(cnn2C2CCCCO2)c1Br
ligand: C1CCC(P(C2CCCCC2)C2CCCCC2)CC1
base: C(=O)(O)[O-].[Na+]
Solvent list for selection:
CC#N,CN(C)C=O,C1CCOC1
Optimal solvent:
| 0 | |
Given the rest of reaction components:
reactant 1: CC1(C)OB(c2ccc3ncccc3c2)OC1(C)C
reactant 2: Cc1ccc2c(cnn2C2CCCCO2)c1Br
ligand: Cc1ccccc1P(c1ccccc1C)c1ccccc1C
base: C(=O)(O)[O-].[Na+]
Solvent list for selection:
CN(C)C=O,C1CCOC1,CC#N
Optimal solvent:
| 1 | |
Given the rest of reaction components:
reactant 1: CC1(C)OB(c2ccc3ncccc3c2)OC1(C)C
reactant 2: Cc1ccc2c(cnn2C2CCCCO2)c1Br
ligand: CCCCP(C12CC3CC(CC(C3)C1)C2)C12CC3CC(CC(C3)C1)C2
base: C(=O)(O)[O-].[Na+]
Solvent list for selection:
C1CCOC1,CC#N,CN(C)C=O
Optimal solvent:
| 0 | |
Given the rest of reaction components:
reactant 1: CC1(C)OB(c2ccc3ncccc3c2)OC1(C)C
reactant 2: Cc1ccc2c(cnn2C2CCCCO2)c1Br
ligand: COc1cccc(OC)c1-c1ccccc1P(C1CCCCC1)C1CCCCC1
base: C(=O)(O)[O-].[Na+]
Solvent list for selection:
CC#N,C1CCOC1,CN(C)C=O
Optimal solvent:
| 1 | |
Given the rest of reaction components:
reactant 1: CC1(C)OB(c2ccc3ncccc3c2)OC1(C)C
reactant 2: Cc1ccc2c(cnn2C2CCCCO2)c1Br
ligand: CC(C)(C)P([C]1C=C[CH][C@@H]1[Fe]C1C=CC=C1P(C(C)(C)C)C(C)(C)C)C(C)(C)C
base: C(=O)(O)[O-].[Na+]
Solvent list for selection:
CN(C)C=O,CC#N,C1CCOC1
Optimal solvent:
| 2 | |
Given the rest of reaction components:
reactant 1: CC1(C)OB(c2ccc3ncccc3c2)OC1(C)C
reactant 2: Cc1ccc2c(cnn2C2CCCCO2)c1Br
ligand: CC(C)c1cc(C(C)C)c(-c2ccccc2P(C2CCCCC2)C2CCCCC2)c(C(C)C)c1
base: C(=O)(O)[O-].[Na+]
Solvent list for selection:
CN(C)C=O,C1CCOC1,CC#N
Optimal solvent:
| 1 | |
Given the rest of reaction components:
reactant 1: CC1(C)OB(c2ccc3ncccc3c2)OC1(C)C
reactant 2: Cc1ccc2c(cnn2C2CCCCO2)c1Br
ligand: C1=C[C@H]2[Fe][C@@H]1[C]2P(c1ccccc1)c1ccccc1
base: C(=O)(O)[O-].[Na+]
Solvent list for selection:
CN(C)C=O,C1CCOC1,CC#N
Optimal solvent:
| 2 | |
Given the rest of reaction components:
reactant 1: CC1(C)OB(c2ccc3ncccc3c2)OC1(C)C
reactant 2: Cc1ccc2c(cnn2C2CCCCO2)c1Br
ligand: CC1(C)c2cccc(P(c3ccccc3)c3ccccc3)c2Oc2c(P(c3ccccc3)c3ccccc3)cccc21
base: C(=O)(O)[O-].[Na+]
Solvent list for selection:
CC#N,C1CCOC1,CN(C)C=O
Optimal solvent:
| 0 | |
Given the rest of reaction components:
reactant 1: CC1(C)OB(c2ccc3ncccc3c2)OC1(C)C
reactant 2: Cc1ccc2c(cnn2C2CCCCO2)c1Br
ligand: CC(C)(C)P(C(C)(C)C)C(C)(C)C
base: CCN(CC)CC
Solvent list for selection:
C1CCOC1,CN(C)C=O,CC#N
Optimal solvent:
| 0 | |
Given the rest of reaction components:
reactant 1: CC1(C)OB(c2ccc3ncccc3c2)OC1(C)C
reactant 2: Cc1ccc2c(cnn2C2CCCCO2)c1Br
ligand: c1ccc(P(c2ccccc2)c2ccccc2)cc1
base: CCN(CC)CC
Solvent list for selection:
C1CCOC1,CC#N,CN(C)C=O
Optimal solvent:
| 0 | |
Given the rest of reaction components:
reactant 1: CC1(C)OB(c2ccc3ncccc3c2)OC1(C)C
reactant 2: Cc1ccc2c(cnn2C2CCCCO2)c1Br
ligand: CN(C)Cc1ccc(P(C(C)(C)C)C(C)(C)C)cc1
base: CCN(CC)CC
Solvent list for selection:
C1CCOC1,CN(C)C=O,CC#N
Optimal solvent:
| 2 | |
Given the rest of reaction components:
reactant 1: CC1(C)OB(c2ccc3ncccc3c2)OC1(C)C
reactant 2: Cc1ccc2c(cnn2C2CCCCO2)c1Br
ligand: C1CCC(P(C2CCCCC2)C2CCCCC2)CC1
base: CCN(CC)CC
Solvent list for selection:
CN(C)C=O,C1CCOC1,CC#N
Optimal solvent:
| 0 | |
Given the rest of reaction components:
reactant 1: CC1(C)OB(c2ccc3ncccc3c2)OC1(C)C
reactant 2: Cc1ccc2c(cnn2C2CCCCO2)c1Br
ligand: Cc1ccccc1P(c1ccccc1C)c1ccccc1C
base: CCN(CC)CC
Solvent list for selection:
CN(C)C=O,C1CCOC1,CC#N
Optimal solvent:
| 1 | |
Given the rest of reaction components:
reactant 1: CC1(C)OB(c2ccc3ncccc3c2)OC1(C)C
reactant 2: Cc1ccc2c(cnn2C2CCCCO2)c1Br
ligand: CCCCP(C12CC3CC(CC(C3)C1)C2)C12CC3CC(CC(C3)C1)C2
base: CCN(CC)CC
Solvent list for selection:
C1CCOC1,CN(C)C=O,CC#N
Optimal solvent:
| 0 | |
Given the rest of reaction components:
reactant 1: CC1(C)OB(c2ccc3ncccc3c2)OC1(C)C
reactant 2: Cc1ccc2c(cnn2C2CCCCO2)c1Br
ligand: COc1cccc(OC)c1-c1ccccc1P(C1CCCCC1)C1CCCCC1
base: CCN(CC)CC
Solvent list for selection:
CN(C)C=O,C1CCOC1,CC#N
Optimal solvent:
| 1 | |
Given the rest of reaction components:
reactant 1: CC1(C)OB(c2ccc3ncccc3c2)OC1(C)C
reactant 2: Cc1ccc2c(cnn2C2CCCCO2)c1Br
ligand: CC(C)(C)P([C]1C=C[CH][C@@H]1[Fe]C1C=CC=C1P(C(C)(C)C)C(C)(C)C)C(C)(C)C
base: CCN(CC)CC
Solvent list for selection:
CC#N,CN(C)C=O,C1CCOC1
Optimal solvent:
| 2 | |
Given the rest of reaction components:
reactant 1: CC1(C)OB(c2ccc3ncccc3c2)OC1(C)C
reactant 2: Cc1ccc2c(cnn2C2CCCCO2)c1Br
ligand: CC(C)c1cc(C(C)C)c(-c2ccccc2P(C2CCCCC2)C2CCCCC2)c(C(C)C)c1
base: CCN(CC)CC
Solvent list for selection:
C1CCOC1,CN(C)C=O,CC#N
Optimal solvent:
| 0 | |
Given the rest of reaction components:
reactant 1: CC1(C)OB(c2ccc3ncccc3c2)OC1(C)C
reactant 2: Cc1ccc2c(cnn2C2CCCCO2)c1Br
ligand: C1=C[C@H]2[Fe][C@@H]1[C]2P(c1ccccc1)c1ccccc1
base: CCN(CC)CC
Solvent list for selection:
CN(C)C=O,CC#N,C1CCOC1
Optimal solvent:
| 1 | |
Given the rest of reaction components:
reactant 1: CC1(C)OB(c2ccc3ncccc3c2)OC1(C)C
reactant 2: Cc1ccc2c(cnn2C2CCCCO2)c1Br
ligand: CC1(C)c2cccc(P(c3ccccc3)c3ccccc3)c2Oc2c(P(c3ccccc3)c3ccccc3)cccc21
base: CCN(CC)CC
Solvent list for selection:
CN(C)C=O,CC#N,C1CCOC1
Optimal solvent:
| 1 | |
Given the rest of reaction components:
reactant 1: CC1(C)OB(c2ccc3ncccc3c2)OC1(C)C
reactant 2: Cc1ccc2c(cnn2C2CCCCO2)c1Br
ligand: CC(C)(C)P(C(C)(C)C)C(C)(C)C
base: [F-].[Cs+]
Solvent list for selection:
CC#N,CN(C)C=O,C1CCOC1
Optimal solvent:
| 2 | |
Given the rest of reaction components:
reactant 1: CC1(C)OB(c2ccc3ncccc3c2)OC1(C)C
reactant 2: Cc1ccc2c(cnn2C2CCCCO2)c1Br
ligand: c1ccc(P(c2ccccc2)c2ccccc2)cc1
base: [F-].[Cs+]
Solvent list for selection:
CN(C)C=O,CC#N,C1CCOC1
Optimal solvent:
| 2 | |
Given the rest of reaction components:
reactant 1: CC1(C)OB(c2ccc3ncccc3c2)OC1(C)C
reactant 2: Cc1ccc2c(cnn2C2CCCCO2)c1Br
ligand: CN(C)Cc1ccc(P(C(C)(C)C)C(C)(C)C)cc1
base: [F-].[Cs+]
Solvent list for selection:
C1CCOC1,CC#N,CN(C)C=O
Optimal solvent:
| 1 | |
Given the rest of reaction components:
reactant 1: CC1(C)OB(c2ccc3ncccc3c2)OC1(C)C
reactant 2: Cc1ccc2c(cnn2C2CCCCO2)c1Br
ligand: C1CCC(P(C2CCCCC2)C2CCCCC2)CC1
base: [F-].[Cs+]
Solvent list for selection:
CN(C)C=O,C1CCOC1,CC#N
Optimal solvent:
| 2 | |
Given the rest of reaction components:
reactant 1: CC1(C)OB(c2ccc3ncccc3c2)OC1(C)C
reactant 2: Cc1ccc2c(cnn2C2CCCCO2)c1Br
ligand: Cc1ccccc1P(c1ccccc1C)c1ccccc1C
base: [F-].[Cs+]
Solvent list for selection:
CN(C)C=O,C1CCOC1,CC#N
Optimal solvent:
| 2 | |
Given the rest of reaction components:
reactant 1: CC1(C)OB(c2ccc3ncccc3c2)OC1(C)C
reactant 2: Cc1ccc2c(cnn2C2CCCCO2)c1Br
ligand: CCCCP(C12CC3CC(CC(C3)C1)C2)C12CC3CC(CC(C3)C1)C2
base: [F-].[Cs+]
Solvent list for selection:
CC#N,CN(C)C=O,C1CCOC1
Optimal solvent:
| 0 | |
Given the rest of reaction components:
reactant 1: CC1(C)OB(c2ccc3ncccc3c2)OC1(C)C
reactant 2: Cc1ccc2c(cnn2C2CCCCO2)c1Br
ligand: COc1cccc(OC)c1-c1ccccc1P(C1CCCCC1)C1CCCCC1
base: [F-].[Cs+]
Solvent list for selection:
CN(C)C=O,CC#N,C1CCOC1
Optimal solvent:
| 1 | |
Given the rest of reaction components:
reactant 1: CC1(C)OB(c2ccc3ncccc3c2)OC1(C)C
reactant 2: Cc1ccc2c(cnn2C2CCCCO2)c1Br
ligand: CC(C)(C)P([C]1C=C[CH][C@@H]1[Fe]C1C=CC=C1P(C(C)(C)C)C(C)(C)C)C(C)(C)C
base: [F-].[Cs+]
Solvent list for selection:
CN(C)C=O,CC#N,C1CCOC1
Optimal solvent:
| 2 | |
Given the rest of reaction components:
reactant 1: CC1(C)OB(c2ccc3ncccc3c2)OC1(C)C
reactant 2: Cc1ccc2c(cnn2C2CCCCO2)c1Br
ligand: CC(C)c1cc(C(C)C)c(-c2ccccc2P(C2CCCCC2)C2CCCCC2)c(C(C)C)c1
base: [F-].[Cs+]
Solvent list for selection:
CN(C)C=O,C1CCOC1,CC#N
Optimal solvent:
| 2 | |
Given the rest of reaction components:
reactant 1: CC1(C)OB(c2ccc3ncccc3c2)OC1(C)C
reactant 2: Cc1ccc2c(cnn2C2CCCCO2)c1Br
ligand: C1=C[C@H]2[Fe][C@@H]1[C]2P(c1ccccc1)c1ccccc1
base: [F-].[Cs+]
Solvent list for selection:
C1CCOC1,CN(C)C=O,CC#N
Optimal solvent:
| 1 | |
Given the rest of reaction components:
reactant 1: CC1(C)OB(c2ccc3ncccc3c2)OC1(C)C
reactant 2: Cc1ccc2c(cnn2C2CCCCO2)c1Br
ligand: CC1(C)c2cccc(P(c3ccccc3)c3ccccc3)c2Oc2c(P(c3ccccc3)c3ccccc3)cccc21
base: [F-].[Cs+]
Solvent list for selection:
C1CCOC1,CC#N,CN(C)C=O
Optimal solvent:
| 1 | |
Given the rest of reaction components:
reactant 1: CC1(C)OB(c2ccc3ncccc3c2)OC1(C)C
reactant 2: Cc1ccc2c(cnn2C2CCCCO2)c1Br
ligand: CC(C)(C)P(C(C)(C)C)C(C)(C)C
base: [O-]P(=O)([O-])[O-].[K+].[K+].[K+]
Solvent list for selection:
CN(C)C=O,C1CCOC1,CC#N
Optimal solvent:
| 2 | |
Given the rest of reaction components:
reactant 1: CC1(C)OB(c2ccc3ncccc3c2)OC1(C)C
reactant 2: Cc1ccc2c(cnn2C2CCCCO2)c1Br
ligand: c1ccc(P(c2ccccc2)c2ccccc2)cc1
base: [O-]P(=O)([O-])[O-].[K+].[K+].[K+]
Solvent list for selection:
CN(C)C=O,CC#N,C1CCOC1
Optimal solvent:
| 0 | |
Given the rest of reaction components:
reactant 1: CC1(C)OB(c2ccc3ncccc3c2)OC1(C)C
reactant 2: Cc1ccc2c(cnn2C2CCCCO2)c1Br
ligand: CN(C)Cc1ccc(P(C(C)(C)C)C(C)(C)C)cc1
base: [O-]P(=O)([O-])[O-].[K+].[K+].[K+]
Solvent list for selection:
C1CCOC1,CN(C)C=O,CC#N
Optimal solvent:
| 2 | |
Given the rest of reaction components:
reactant 1: CC1(C)OB(c2ccc3ncccc3c2)OC1(C)C
reactant 2: Cc1ccc2c(cnn2C2CCCCO2)c1Br
ligand: C1CCC(P(C2CCCCC2)C2CCCCC2)CC1
base: [O-]P(=O)([O-])[O-].[K+].[K+].[K+]
Solvent list for selection:
C1CCOC1,CN(C)C=O,CC#N
Optimal solvent:
| 1 | |
Given the rest of reaction components:
reactant 1: CC1(C)OB(c2ccc3ncccc3c2)OC1(C)C
reactant 2: Cc1ccc2c(cnn2C2CCCCO2)c1Br
ligand: Cc1ccccc1P(c1ccccc1C)c1ccccc1C
base: [O-]P(=O)([O-])[O-].[K+].[K+].[K+]
Solvent list for selection:
C1CCOC1,CN(C)C=O,CC#N
Optimal solvent:
| 2 | |
Given the rest of reaction components:
reactant 1: CC1(C)OB(c2ccc3ncccc3c2)OC1(C)C
reactant 2: Cc1ccc2c(cnn2C2CCCCO2)c1Br
ligand: CCCCP(C12CC3CC(CC(C3)C1)C2)C12CC3CC(CC(C3)C1)C2
base: [O-]P(=O)([O-])[O-].[K+].[K+].[K+]
Solvent list for selection:
CN(C)C=O,C1CCOC1,CC#N
Optimal solvent:
| 2 | |
Given the rest of reaction components:
reactant 1: CC1(C)OB(c2ccc3ncccc3c2)OC1(C)C
reactant 2: Cc1ccc2c(cnn2C2CCCCO2)c1Br
ligand: COc1cccc(OC)c1-c1ccccc1P(C1CCCCC1)C1CCCCC1
base: [O-]P(=O)([O-])[O-].[K+].[K+].[K+]
Solvent list for selection:
C1CCOC1,CN(C)C=O,CC#N
Optimal solvent:
| 1 | |
Given the rest of reaction components:
reactant 1: CC1(C)OB(c2ccc3ncccc3c2)OC1(C)C
reactant 2: Cc1ccc2c(cnn2C2CCCCO2)c1Br
ligand: CC(C)(C)P([C]1C=C[CH][C@@H]1[Fe]C1C=CC=C1P(C(C)(C)C)C(C)(C)C)C(C)(C)C
base: [O-]P(=O)([O-])[O-].[K+].[K+].[K+]
Solvent list for selection:
CC#N,C1CCOC1,CN(C)C=O
Optimal solvent:
| 1 | |
Given the rest of reaction components:
reactant 1: CC1(C)OB(c2ccc3ncccc3c2)OC1(C)C
reactant 2: Cc1ccc2c(cnn2C2CCCCO2)c1Br
ligand: CC(C)c1cc(C(C)C)c(-c2ccccc2P(C2CCCCC2)C2CCCCC2)c(C(C)C)c1
base: [O-]P(=O)([O-])[O-].[K+].[K+].[K+]
Solvent list for selection:
CC#N,C1CCOC1,CN(C)C=O
Optimal solvent:
| 0 | |
Given the rest of reaction components:
reactant 1: CC1(C)OB(c2ccc3ncccc3c2)OC1(C)C
reactant 2: Cc1ccc2c(cnn2C2CCCCO2)c1Br
ligand: C1=C[C@H]2[Fe][C@@H]1[C]2P(c1ccccc1)c1ccccc1
base: [O-]P(=O)([O-])[O-].[K+].[K+].[K+]
Solvent list for selection:
CN(C)C=O,C1CCOC1,CC#N
Optimal solvent:
| 2 | |
Given the rest of reaction components:
reactant 1: CC1(C)OB(c2ccc3ncccc3c2)OC1(C)C
reactant 2: Cc1ccc2c(cnn2C2CCCCO2)c1Br
ligand: CC1(C)c2cccc(P(c3ccccc3)c3ccccc3)c2Oc2c(P(c3ccccc3)c3ccccc3)cccc21
base: [O-]P(=O)([O-])[O-].[K+].[K+].[K+]
Solvent list for selection:
CN(C)C=O,C1CCOC1,CC#N
Optimal solvent:
| 2 |
Subsets and Splits
No community queries yet
The top public SQL queries from the community will appear here once available.